ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-30-0 trans-Stilbene |
|
| 상품명칭 | trans-Stilbene |
| 영문 이름 | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
| 분자식 | C14H12 |
| 분자량 | 180.2451 |
| InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| cas번호 | 103-30-0 |
| EC번호 | 203-098-5 |
| 분자 구조 | ![]() |
| 밀도 | 1.044g/cm3 |
| 녹는 점 | 122-126℃ |
| 비등점 | 307°C at 760 mmHg |
| 굴절 지수 | 1.658 |
| 인화점 | 128.5°C |
| 증기압 | 0.00135mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |