ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-30-0 trans-Stilbene |
|
| Naam product | trans-Stilbene |
| Engelse naam | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
| MF | C14H12 |
| Molecuulgewicht | 180.2451 |
| InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| CAS-nummer | 103-30-0 |
| EINECS | 203-098-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.044g/cm3 |
| Smeltpunt | 122-126℃ |
| Kookpunt | 307°C at 760 mmHg |
| Brekingsindex | 1.658 |
| Vlampunt | 128.5°C |
| Dampdruk | 0.00135mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |