ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
401-56-9 ethylchlorofluoroacetate |
|
| Nome del prodotto | ethylchlorofluoroacetate |
| Nome inglese | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
| Formula molecolare | C4H6ClFO2 |
| Peso Molecolare | 140.5406 |
| InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| Numero CAS | 401-56-9 |
| EINECS | 206-930-5 |
| Struttura molecolare | ![]() |
| Densità | 1.219g/cm3 |
| Punto di ebollizione | 129°C at 760 mmHg |
| Indice di rifrazione | 1.39 |
| Punto d'infiammabilità | 44.3°C |
| Pressione di vapore | 10.4mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |