Chemindex > 401-56-9
NO ▼
401-56-9 ethylchlorofluoroacetate |
|
| produktnavn | ethylchlorofluoroacetate |
| Engelsk navn | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
| Molekylær Formel | C4H6ClFO2 |
| Molekylvekt | 140.5406 |
| InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| CAS-nummer | 401-56-9 |
| EINECS | 206-930-5 |
| Molecular Structure |  |
| Tetthet | 1.219g/cm3 |
| Kokepunkt | 129°C at 760 mmHg |
| Brytningsindeks | 1.39 |
| Flammepunktet | 44.3°C |
| Damptrykk | 10.4mmHg at 25°C |
| Hazard symboler |  C##Corrosive:; |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 