ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
401-56-9 ethylchlorofluoroacetate |
|
| Nome do produto | ethylchlorofluoroacetate |
| Nome em inglês | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
| Fórmula molecular | C4H6ClFO2 |
| Peso Molecular | 140.5406 |
| InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| CAS Registry Number | 401-56-9 |
| EINECS | 206-930-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.219g/cm3 |
| Ponto de ebulição | 129°C at 760 mmHg |
| índice de refração | 1.39 |
| O ponto de inflamação | 44.3°C |
| Pressão de vapor | 10.4mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |