ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59483-79-3 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
|
| Nome del prodotto | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
| Nome inglese | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile; |
| Formula molecolare | C16H13NO |
| Peso Molecolare | 235.2805 |
| InChI | InChI=1/C16H13NO/c1-12-2-8-15(9-3-12)16(18)10-13-4-6-14(11-17)7-5-13/h2-9H,10H2,1H3 |
| Numero CAS | 59483-79-3 |
| Struttura molecolare | ![]() |
| Densità | 1.14g/cm3 |
| Punto di ebollizione | 414.8°C at 760 mmHg |
| Indice di rifrazione | 1.595 |
| Punto d'infiammabilità | 204.7°C |
| Pressione di vapore | 4.33E-07mmHg at 25°C |
| MSDS | |