ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59483-79-3 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
|
| Nome do produto | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
| Nome em inglês | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile; |
| Fórmula molecular | C16H13NO |
| Peso Molecular | 235.2805 |
| InChI | InChI=1/C16H13NO/c1-12-2-8-15(9-3-12)16(18)10-13-4-6-14(11-17)7-5-13/h2-9H,10H2,1H3 |
| CAS Registry Number | 59483-79-3 |
| Estrutura Molecular | ![]() |
| Densidade | 1.14g/cm3 |
| Ponto de ebulição | 414.8°C at 760 mmHg |
| índice de refração | 1.595 |
| O ponto de inflamação | 204.7°C |
| Pressão de vapor | 4.33E-07mmHg at 25°C |
| MSDS | |