ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59483-79-3 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
|
| Naam product | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
| Engelse naam | 4-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile; |
| MF | C16H13NO |
| Molecuulgewicht | 235.2805 |
| InChI | InChI=1/C16H13NO/c1-12-2-8-15(9-3-12)16(18)10-13-4-6-14(11-17)7-5-13/h2-9H,10H2,1H3 |
| CAS-nummer | 59483-79-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.14g/cm3 |
| Kookpunt | 414.8°C at 760 mmHg |
| Brekingsindex | 1.595 |
| Vlampunt | 204.7°C |
| Dampdruk | 4.33E-07mmHg at 25°C |
| MSDS | |