ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70748-53-7 anti-5-carbossitriciclo[2.2.1.0(2,6)]eptan-3-one |
|
Nome del prodotto | anti-5-carbossitriciclo[2.2.1.0(2,6)]eptan-3-one |
Sinonimi | acido 5-ossotriciclo(2.2.1.0(2,6))eptano-3-carbossilico; NSC 666436 |
Nome inglese | anti-5-Carboxytricyclo[2.2.1.0(2,6)]heptan-3-one;5-Oxotricyclo(2.2.1.0(2,6))heptane-3-carboxylic acid;NSC 666436 |
Formula molecolare | C8H8O3 |
Peso Molecolare | 152.14 |
InChI | InChI=1/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11) |
Numero CAS | 70748-53-7 |
Struttura molecolare | ![]() |
Punto di fusione | 143-146℃ |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |