ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70748-53-7 anti-5-Carboxitriciclo[2.2.1.0(2,6)]heptano-3-ona |
|
Nome do produto | anti-5-Carboxitriciclo[2.2.1.0(2,6)]heptano-3-ona |
Sinônimos | ácido 5-oxotriciclo(2.2.1.0(2,6))heptano-3-carboxílico; NSC 666436 |
Nome em inglês | anti-5-Carboxytricyclo[2.2.1.0(2,6)]heptan-3-one;5-Oxotricyclo(2.2.1.0(2,6))heptane-3-carboxylic acid;NSC 666436 |
Fórmula molecular | C8H8O3 |
Peso Molecular | 152.14 |
InChI | InChI=1/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11) |
CAS Registry Number | 70748-53-7 |
Estrutura Molecular | ![]() |
Ponto de fusão | 143-146℃ |
Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
MSDS |