Chemindex > 70748-53-7
NO ▼
70748-53-7 anti-5-karboksytrisyklo[2.2.1.0(2,6)]heptan-3-on |
|
| produktnavn | anti-5-karboksytrisyklo[2.2.1.0(2,6)]heptan-3-on |
| Synonymer | 5-oksotricyklo(2.2.1.0(2,6))heptan-3-karboksylsyre; NSC 666436 |
| Engelsk navn | anti-5-Carboxytricyclo[2.2.1.0(2,6)]heptan-3-one;5-Oxotricyclo(2.2.1.0(2,6))heptane-3-carboxylic acid;NSC 666436 |
| Molekylær Formel | C8H8O3 |
| Molekylvekt | 152.14 |
| InChI | InChI=1/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11) |
| CAS-nummer | 70748-53-7 |
| Molecular Structure | ![70748-53-7 anti-5-karboksytrisyklo[2.2.1.0(2,6)]heptan-3-on](https://images-a.chemnet.com/suppliers/chembase/183/1836.gif "70748-53-7 anti-5-karboksytrisyklo[2.2.1.0(2,6)]heptan-3-on") |
| Smeltepunkt | 143-146℃ |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 70748-53-7 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 