ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
481-42-5 Plumbagin |
|
상품명칭 | Plumbagin |
영문 이름 | Plumbagin;5-Hydroxy-2-methyl-1,4-naphthoquinone;Plumbagin,95%;Plumbagin from Plumbago indica;5-hydroxy-2-methylnaphthalene-1,4-dione |
분자식 | C11H8O3 |
분자량 | 188.1794 |
InChI | InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
cas번호 | 481-42-5 |
EC번호 | 207-569-6 |
분자 구조 | ![]() |
밀도 | 1.354g/cm3 |
녹는 점 | 75-78℃ |
비등점 | 383.9°C at 760 mmHg |
굴절 지수 | 1.63 |
인화점 | 200.2°C |
증기압 | 1.92E-06mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |