ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
481-42-5 Plumbagin |
|
Nazwa produktu: | Plumbagin |
Angielska nazwa | Plumbagin;5-Hydroxy-2-methyl-1,4-naphthoquinone;Plumbagin,95%;Plumbagin from Plumbago indica;5-hydroxy-2-methylnaphthalene-1,4-dione |
MF | C11H8O3 |
Masie cząsteczkowej | 188.1794 |
InChI | InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
Nr CAS | 481-42-5 |
EINECS | 207-569-6 |
Struktury molekularnej | ![]() |
Gęstość | 1.354g/cm3 |
Temperatura topnienia | 75-78℃ |
Temperatura wrzenia | 383.9°C at 760 mmHg |
Współczynnik załamania | 1.63 |
Temperatura zapłonu | 200.2°C |
Ciśnienie pary | 1.92E-06mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |