ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
481-42-5 Plumbagin |
|
produktnavn | Plumbagin |
Engelsk navn | Plumbagin;5-Hydroxy-2-methyl-1,4-naphthoquinone;Plumbagin,95%;Plumbagin from Plumbago indica;5-hydroxy-2-methylnaphthalene-1,4-dione |
Molekylær Formel | C11H8O3 |
Molekylvekt | 188.1794 |
InChI | InChI=1/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
CAS-nummer | 481-42-5 |
EINECS | 207-569-6 |
Molecular Structure | ![]() |
Tetthet | 1.354g/cm3 |
Smeltepunkt | 75-78℃ |
Kokepunkt | 383.9°C at 760 mmHg |
Brytningsindeks | 1.63 |
Flammepunktet | 200.2°C |
Damptrykk | 1.92E-06mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |