ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-78-9 4-Aminohippuric acid |
|
| 상품명칭 | 4-Aminohippuric acid |
| 영문 이름 | 4-Aminohippuric acid;PAH;p-Aminohippuric Acid (1.00084);4-Aminohippuric acid = N-(4-Aminobenzoyl)-glycin;4-Aminohippuric acid;[N-(4-Aminobenzoyl)glycine];N-(4-Aminobenzoyl)glycine;N-(4-aminobenzoyl)-glycine;{[(4-aminophenyl)carbonyl]amino}acetate;p-Aminohippuric acid |
| 분자식 | C9H9N2O3 |
| 분자량 | 193.1799 |
| InChI | InChI=1/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/p-1 |
| cas번호 | 61-78-9 |
| EC번호 | 200-518-9 |
| 분자 구조 | ![]() |
| 녹는 점 | 197-200℃ |
| 비등점 | 517.2°C at 760 mmHg |
| 인화점 | 266.6°C |
| 증기압 | 1.6E-11mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |