ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-78-9 4-Aminohippuric acid |
|
| Nome do produto | 4-Aminohippuric acid |
| Nome em inglês | 4-Aminohippuric acid;PAH;p-Aminohippuric Acid (1.00084);4-Aminohippuric acid = N-(4-Aminobenzoyl)-glycin;4-Aminohippuric acid;[N-(4-Aminobenzoyl)glycine];N-(4-Aminobenzoyl)glycine;N-(4-aminobenzoyl)-glycine;{[(4-aminophenyl)carbonyl]amino}acetate;p-Aminohippuric acid |
| Fórmula molecular | C9H9N2O3 |
| Peso Molecular | 193.1799 |
| InChI | InChI=1/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/p-1 |
| CAS Registry Number | 61-78-9 |
| EINECS | 200-518-9 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 197-200℃ |
| Ponto de ebulição | 517.2°C at 760 mmHg |
| O ponto de inflamação | 266.6°C |
| Pressão de vapor | 1.6E-11mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |