ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-78-9 4-Aminohippuric acid |
|
| produktnavn | 4-Aminohippuric acid |
| Engelsk navn | 4-Aminohippuric acid;PAH;p-Aminohippuric Acid (1.00084);4-Aminohippuric acid = N-(4-Aminobenzoyl)-glycin;4-Aminohippuric acid;[N-(4-Aminobenzoyl)glycine];N-(4-Aminobenzoyl)glycine;N-(4-aminobenzoyl)-glycine;{[(4-aminophenyl)carbonyl]amino}acetate;p-Aminohippuric acid |
| Molekylær Formel | C9H9N2O3 |
| Molekylvekt | 193.1799 |
| InChI | InChI=1/C9H10N2O3/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13/h1-4H,5,10H2,(H,11,14)(H,12,13)/p-1 |
| CAS-nummer | 61-78-9 |
| EINECS | 200-518-9 |
| Molecular Structure | ![]() |
| Smeltepunkt | 197-200℃ |
| Kokepunkt | 517.2°C at 760 mmHg |
| Flammepunktet | 266.6°C |
| Damptrykk | 1.6E-11mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |