ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70750-12-8 옥탄산, 2-[(2-아미노에틸)아미노]에탄올과의 반응 생성물 |
|
상품명칭 | 옥탄산, 2-[(2-아미노에틸)아미노]에탄올과의 반응 생성물 |
별명 | 옥탄산, 2-((2-아미노에틸)아미노)에탄올과의 반응 생성물; 카프릴산, 아미노에틸에탄올아민 반응 생성물; 옥탄산과 아미노에틸에탄올아민의 반응 생성물; 옥탄산 - 2- [(2- 아미노 에틸) 아미노] 에탄올 (1 : 1); |
영문 이름 | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol;Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol;Caprylic acid, aminoethylethanolamine reaction product;Reaction products of octanoic acid with aminoethylethanolamine;octanoic acid - 2-[(2-aminoethyl)amino]ethanol (1:1) |
분자식 | C12H28N2O3 |
분자량 | 248.3623 |
InChI | InChI=1/C8H16O2.C4H12N2O/c1-2-3-4-5-6-7-8(9)10;5-1-2-6-3-4-7/h2-7H2,1H3,(H,9,10);6-7H,1-5H2 |
cas번호 | 70750-12-8 |
EC번호 | 274-839-8 |
분자 구조 | ![]() |
비등점 | 239.3°C at 760 mmHg |
인화점 | 107.4°C |
증기압 | 0.022mmHg at 25°C |
MSDS |