ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70750-12-8 Oktanoik asit, 2- [(2-aminoetil)amino] etanol ile reaksiyon ürünleri |
|
Ürün Adı | Oktanoik asit, 2- [(2-aminoetil)amino] etanol ile reaksiyon ürünleri |
Eş anlamlı | Oktanoik asit, 2- ((2-aminoetil) amino) etanol ile reaksiyon ürünleri; Kaprilik asit, aminoetiletanolamin reaksiyon ürünü; Oktanoik asidin aminoetiletanolamin ile reaksiyon ürünleri; oktanoik asit - 2-[(2-aminoetil)amino]etanol (1:1); |
ingilizce adı | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol;Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol;Caprylic acid, aminoethylethanolamine reaction product;Reaction products of octanoic acid with aminoethylethanolamine;octanoic acid - 2-[(2-aminoethyl)amino]ethanol (1:1) |
Moleküler Formülü | C12H28N2O3 |
Molekül Ağırlığı | 248.3623 |
InChI | InChI=1/C8H16O2.C4H12N2O/c1-2-3-4-5-6-7-8(9)10;5-1-2-6-3-4-7/h2-7H2,1H3,(H,9,10);6-7H,1-5H2 |
CAS kayıt numarası | 70750-12-8 |
EINECS | 274-839-8 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 239.3°C at 760 mmHg |
Alevlenme noktası | 107.4°C |
Buhar basıncı | 0.022mmHg at 25°C |
MSDS |