Chemindex > 70750-12-8
NO ▼
70750-12-8 Oktansyre, reaksjonsprodukter med 2-[(2-aminoetyl)amino]etanol |
|
| produktnavn | Oktansyre, reaksjonsprodukter med 2-[(2-aminoetyl)amino]etanol |
| Synonymer | Oktansyre, reaksjonsprodukter med 2-((2-aminoetyl)amino)etanol; Kaprylsyre, aminoetyletanolaminreaksjonsprodukt; Reaksjonsprodukter av oktansyre med aminoetyletanolamin; oktansyre - 2-[(2-aminoetyl)amino]etanol (1:1); |
| Engelsk navn | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol;Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol;Caprylic acid, aminoethylethanolamine reaction product;Reaction products of octanoic acid with aminoethylethanolamine;octanoic acid - 2-[(2-aminoethyl)amino]ethanol (1:1) |
| Molekylær Formel | C12H28N2O3 |
| Molekylvekt | 248.3623 |
| InChI | InChI=1/C8H16O2.C4H12N2O/c1-2-3-4-5-6-7-8(9)10;5-1-2-6-3-4-7/h2-7H2,1H3,(H,9,10);6-7H,1-5H2 |
| CAS-nummer | 70750-12-8 |
| EINECS | 274-839-8 |
| Molecular Structure | ![70750-12-8 Oktansyre, reaksjonsprodukter med 2-[(2-aminoetyl)amino]etanol](https://images-a.chemnet.com/suppliers/chembase/cas6/cas70750-12-8.gif "70750-12-8 Oktansyre, reaksjonsprodukter med 2-[(2-aminoetyl)amino]etanol") |
| Kokepunkt | 239.3°C at 760 mmHg |
| Flammepunktet | 107.4°C |
| Damptrykk | 0.022mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 70750-12-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 