Chemindex > 7149-69-1
KR ▼
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene |
|
| 상품명칭 | 1,3-dichloro-2-methyl-5-nitrobenzene |
| 영문 이름 | 1,3-dichloro-2-methyl-5-nitrobenzene;2,6-Dichloro-4-nitrotoluene |
| 분자식 | C7H5Cl2NO2 |
| 분자량 | 206.0261 |
| InChI | InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| cas번호 | 7149-69-1 |
| 분자 구조 |  |
| 밀도 | 1.456g/cm3 |
| 녹는 점 | 62℃ |
| 비등점 | 279.6°C at 760 mmHg |
| 굴절 지수 | 1.585 |
| 인화점 | 122.9°C |
| 증기압 | 0.00674mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 