ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene |
|
| produktnavn | 1,3-dichloro-2-methyl-5-nitrobenzene |
| Engelsk navn | 1,3-dichloro-2-methyl-5-nitrobenzene;2,6-Dichloro-4-nitrotoluene |
| Molekylær Formel | C7H5Cl2NO2 |
| Molekylvekt | 206.0261 |
| InChI | InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| CAS-nummer | 7149-69-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.456g/cm3 |
| Smeltepunkt | 62℃ |
| Kokepunkt | 279.6°C at 760 mmHg |
| Brytningsindeks | 1.585 |
| Flammepunktet | 122.9°C |
| Damptrykk | 0.00674mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |