ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene |
|
Nazwa produktu: | 1,3-dichloro-2-methyl-5-nitrobenzene |
Angielska nazwa | 1,3-dichloro-2-methyl-5-nitrobenzene;2,6-Dichloro-4-nitrotoluene |
MF | C7H5Cl2NO2 |
Masie cząsteczkowej | 206.0261 |
InChI | InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
Nr CAS | 7149-69-1 |
Struktury molekularnej | ![]() |
Gęstość | 1.456g/cm3 |
Temperatura topnienia | 62℃ |
Temperatura wrzenia | 279.6°C at 760 mmHg |
Współczynnik załamania | 1.585 |
Temperatura zapłonu | 122.9°C |
Ciśnienie pary | 0.00674mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |