ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene |
|
상품명칭 | 1-(chloromethyl)-2,4-dimethylbenzene |
영문 이름 | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
분자식 | C9H11Cl |
분자량 | 154.6366 |
InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
cas번호 | 824-55-5 |
EC번호 | 212-531-7 |
분자 구조 | ![]() |
밀도 | 1.033g/cm3 |
비등점 | 215.5°C at 760 mmHg |
굴절 지수 | 1.522 |
인화점 | 86.5°C |
증기압 | 0.216mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.||R36##Irritating to eyes.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |