ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene |
|
| Nama produk | 1-(chloromethyl)-2,4-dimethylbenzene |
| Nama Inggeris | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
| MF | C9H11Cl |
| Berat Molekul | 154.6366 |
| InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
| CAS NO | 824-55-5 |
| EINECS | 212-531-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.033g/cm3 |
| Titik didih | 215.5°C at 760 mmHg |
| Indeks bias | 1.522 |
| Titik nyala | 86.5°C |
| Tekanan wap | 0.216mmHg at 25°C |
| Cinta bahaya | |
| Kod Risiko | R34##Causes burns.||R36##Irritating to eyes.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |