ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene |
|
| Nome do produto | 1-(chloromethyl)-2,4-dimethylbenzene |
| Nome em inglês | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
| Fórmula molecular | C9H11Cl |
| Peso Molecular | 154.6366 |
| InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
| CAS Registry Number | 824-55-5 |
| EINECS | 212-531-7 |
| Estrutura Molecular | ![]() |
| Densidade | 1.033g/cm3 |
| Ponto de ebulição | 215.5°C at 760 mmHg |
| índice de refração | 1.522 |
| O ponto de inflamação | 86.5°C |
| Pressão de vapor | 0.216mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.||R36##Irritating to eyes.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |