Chemindex >37578-06-6
MY ▼
37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
|
| Nama produk | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
| Nama Inggeris | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine;2-Amino-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile;2-amino-3-cyano-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium |
| MF | C9H12N3S |
| Berat Molekul | 194.2761 |
| InChI | InChI=1/C9H11N3S/c1-12-3-2-6-7(4-10)9(11)13-8(6)5-12/h2-3,5,11H2,1H3/p+1 |
| CAS NO | 37578-06-6 |
| Struktur Molekul | ![37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine](https://images-a.chemnet.com/suppliers/chembase/497/49755.gif "37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine") |
| Titik lebur | 193℃ |
| Titik didih | 392.4°C at 760 mmHg |
| Titik nyala | 191.1°C |
| Tekanan wap | 2.3E-06mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 37578-06-6 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 