Chemindex > 37578-06-6
SA ▼
37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
|
| اسم المنتج | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
| الاسم بالانجليزية | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine;2-Amino-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile;2-amino-3-cyano-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium |
| الصيغة الجزيئية | C9H12N3S |
| الوزن الجزيئي الغرامي | 194.2761 |
| InChI | InChI=1/C9H11N3S/c1-12-3-2-6-7(4-10)9(11)13-8(6)5-12/h2-3,5,11H2,1H3/p+1 |
| إستراتيجية المساعدة القطرية | 37578-06-6 |
| بنية جزيئية | ![37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine](https://images-a.chemnet.com/suppliers/chembase/497/49755.gif "37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine") |
| درجة الإنصهار | 193℃ |
| نقطة الغليان | 392.4°C at 760 mmHg |
| نقطة الوميض | 191.1°C |
| ضغط البخار | 2.3E-06mmHg at 25°C |
| علامات على البضائع الخطرة |  C##Corrosive:; |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 37578-06-6 (0):
يتم توفير خدمة قاعدة بيانات CAS الكي&# 