ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37578-06-6 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
|
Ürün Adı | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine |
ingilizce adı | 2-Amino-3-cyano-4,5,6,7-tetrahydro-6-methylthieno[2,3-c]piridine;2-Amino-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile;2-amino-3-cyano-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium |
Moleküler Formülü | C9H12N3S |
Molekül Ağırlığı | 194.2761 |
InChI | InChI=1/C9H11N3S/c1-12-3-2-6-7(4-10)9(11)13-8(6)5-12/h2-3,5,11H2,1H3/p+1 |
CAS kayıt numarası | 37578-06-6 |
Moleküler Yapısı | ![]() |
Ergime noktası | 193℃ |
Kaynama noktası | 392.4°C at 760 mmHg |
Alevlenme noktası | 191.1°C |
Buhar basıncı | 2.3E-06mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |