Chemindex >423768-38-1
MY ▼
423768-38-1 1-methyl-1H-1,2,3-benzotriazole-5-karbonil klorida |
|
| Nama produk | 1-methyl-1H-1,2,3-benzotriazole-5-karbonil klorida |
| Sinonim | 1-methyl-1H-benzotriazole-5-karbonil klorida; |
| Nama Inggeris | 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride;1-methyl-1H-benzotriazole-5-carbonyl chloride |
| MF | C8H6ClN3O |
| Berat Molekul | 195.6057 |
| InChI | InChI=1/C8H6ClN3O/c1-12-7-3-2-5(8(9)13)4-6(7)10-11-12/h2-4H,1H3 |
| CAS NO | 423768-38-1 |
| Struktur Molekul |  |
| Kepadatan | 1.5g/cm3 |
| Titik lebur | 123℃ |
| Titik didih | 355.3°C at 760 mmHg |
| Indeks bias | 1.687 |
| Titik nyala | 168.7°C |
| Tekanan wap | 3.16E-05mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 423768-38-1 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 