ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
423768-38-1 1-methyl-1H-1,2,3-benzotriazole-5-karbonil klorida |
|
Nama produk | 1-methyl-1H-1,2,3-benzotriazole-5-karbonil klorida |
Sinonim | 1-methyl-1H-benzotriazole-5-karbonil klorida; |
Nama Inggeris | 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride;1-methyl-1H-benzotriazole-5-carbonyl chloride |
MF | C8H6ClN3O |
Berat Molekul | 195.6057 |
InChI | InChI=1/C8H6ClN3O/c1-12-7-3-2-5(8(9)13)4-6(7)10-11-12/h2-4H,1H3 |
CAS NO | 423768-38-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.5g/cm3 |
Titik lebur | 123℃ |
Titik didih | 355.3°C at 760 mmHg |
Indeks bias | 1.687 |
Titik nyala | 168.7°C |
Tekanan wap | 3.16E-05mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |