ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
423768-38-1 chlorek 1-metylo-1H-1,2,3-benzotriazola-5-karbonylu |
|
Nazwa produktu: | chlorek 1-metylo-1H-1,2,3-benzotriazola-5-karbonylu |
Synonimy | chlorek 1-metylo-1H-benzotriazolo-5-karbonylu; |
Angielska nazwa | 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride;1-methyl-1H-benzotriazole-5-carbonyl chloride |
MF | C8H6ClN3O |
Masie cząsteczkowej | 195.6057 |
InChI | InChI=1/C8H6ClN3O/c1-12-7-3-2-5(8(9)13)4-6(7)10-11-12/h2-4H,1H3 |
Nr CAS | 423768-38-1 |
Struktury molekularnej | ![]() |
Gęstość | 1.5g/cm3 |
Temperatura topnienia | 123℃ |
Temperatura wrzenia | 355.3°C at 760 mmHg |
Współczynnik załamania | 1.687 |
Temperatura zapłonu | 168.7°C |
Ciśnienie pary | 3.16E-05mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |