ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
423768-38-1 1-metil-1H-1,2,3-benzotriazol-5-karbonil klorür |
|
Ürün Adı | 1-metil-1H-1,2,3-benzotriazol-5-karbonil klorür |
Eş anlamlı | 1-metil-1H-benzotriazol-5-karbonil klorür; |
ingilizce adı | 1-methyl-1H-1,2,3-benzotriazole-5-carbonyl chloride;1-methyl-1H-benzotriazole-5-carbonyl chloride |
Moleküler Formülü | C8H6ClN3O |
Molekül Ağırlığı | 195.6057 |
InChI | InChI=1/C8H6ClN3O/c1-12-7-3-2-5(8(9)13)4-6(7)10-11-12/h2-4H,1H3 |
CAS kayıt numarası | 423768-38-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.5g/cm3 |
Ergime noktası | 123℃ |
Kaynama noktası | 355.3°C at 760 mmHg |
Kırılma indisi | 1.687 |
Alevlenme noktası | 168.7°C |
Buhar basıncı | 3.16E-05mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |