ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
133184-80-2 3-amino-4-(1-pyrrolidino)benzotrifluoride |
|
Naam product | 3-amino-4-(1-pyrrolidino)benzotrifluoride |
Synoniemen | N-[2-amino-4-(trifluormethyl)fenyl]pyrrolidine; 2-(pyrrolidine-1-yl)-5-(trifluormethyl)aniline; (2E)-3-(2-chloor-4-fluorfenyl)prop-2-eenzuur; |
Engelse naam | 3-Amino-4-(1-pyrrolidino)benzotrifluoride;N-[2-Amino-4-(trifluoromethyl)phenyl]pyrrolidine;2-(pyrrolidin-1-yl)-5-(trifluoromethyl)aniline;(2E)-3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
MF | C9H6ClFO2 |
Molecuulgewicht | 200.5941 |
InChI | InChI=1/C9H6ClFO2/c10-8-5-7(11)3-1-6(8)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
CAS-nummer | 133184-80-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.42g/cm3 |
Kookpunt | 312.8°C at 760 mmHg |
Brekingsindex | 1.604 |
Vlampunt | 143°C |
Dampdruk | 0.00022mmHg at 25°C |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |