ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
133184-80-2 3-amino-4-(1-pirolidyno)benzotrifluorek |
|
Nazwa produktu: | 3-amino-4-(1-pirolidyno)benzotrifluorek |
Synonimy | N-[2-amino-4-(trifluorometylo)fenylo]pirolidyna; 2-(pirolidyn-1-ylo)-5-(trifluorometylo)anilina; kwas (2E)-3-(2-chloro-4-fluorofenylo)prop-2-enowy; |
Angielska nazwa | 3-Amino-4-(1-pyrrolidino)benzotrifluoride;N-[2-Amino-4-(trifluoromethyl)phenyl]pyrrolidine;2-(pyrrolidin-1-yl)-5-(trifluoromethyl)aniline;(2E)-3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
MF | C9H6ClFO2 |
Masie cząsteczkowej | 200.5941 |
InChI | InChI=1/C9H6ClFO2/c10-8-5-7(11)3-1-6(8)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
Nr CAS | 133184-80-2 |
Struktury molekularnej | ![]() |
Gęstość | 1.42g/cm3 |
Temperatura wrzenia | 312.8°C at 760 mmHg |
Współczynnik załamania | 1.604 |
Temperatura zapłonu | 143°C |
Ciśnienie pary | 0.00022mmHg at 25°C |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |