Chemindex > 133184-80-2
NO ▼
133184-80-2 3-Amino-4-(1-pyrrolidino)benzotrifluorid |
|
| produktnavn | 3-Amino-4-(1-pyrrolidino)benzotrifluorid |
| Synonymer | ; N-[2-amino-4-(trifluormetyl)fenyl]pyrrolidin; 2-(pyrrolidin-1-yl)-5-(trifluormetyl)anilin; (2E)-3-(2-klor-4-fluorfenyl)prop-2-ensyre; |
| Engelsk navn | 3-Amino-4-(1-pyrrolidino)benzotrifluoride;N-[2-Amino-4-(trifluoromethyl)phenyl]pyrrolidine;2-(pyrrolidin-1-yl)-5-(trifluoromethyl)aniline;(2E)-3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
| Molekylær Formel | C9H6ClFO2 |
| Molekylvekt | 200.5941 |
| InChI | InChI=1/C9H6ClFO2/c10-8-5-7(11)3-1-6(8)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| CAS-nummer | 133184-80-2 |
| Molecular Structure |  |
| Tetthet | 1.42g/cm3 |
| Kokepunkt | 312.8°C at 760 mmHg |
| Brytningsindeks | 1.604 |
| Flammepunktet | 143°C |
| Damptrykk | 0.00022mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 133184-80-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 