ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
| produktnavn | Ethyl 2-nitrobenzoate |
| Engelsk navn | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
| Molekylær Formel | C9H9NO4 |
| Molekylvekt | 195.1721 |
| InChI | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| CAS-nummer | 610-34-4 |
| EINECS | 210-220-0 |
| Molecular Structure | ![]() |
| Tetthet | 1.253g/cm3 |
| Smeltepunkt | 26-174℃ |
| Kokepunkt | 275°C at 760 mmHg |
| Brytningsindeks | 1.544 |
| Flammepunktet | 126.1°C |
| Damptrykk | 0.00523mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |