ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
| Nome do produto | Ethyl 2-nitrobenzoate |
| Nome em inglês | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
| Fórmula molecular | C9H9NO4 |
| Peso Molecular | 195.1721 |
| InChI | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| CAS Registry Number | 610-34-4 |
| EINECS | 210-220-0 |
| Estrutura Molecular | ![]() |
| Densidade | 1.253g/cm3 |
| Ponto de fusão | 26-174℃ |
| Ponto de ebulição | 275°C at 760 mmHg |
| índice de refração | 1.544 |
| O ponto de inflamação | 126.1°C |
| Pressão de vapor | 0.00523mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |