ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
| Nazwa produktu: | Ethyl 2-nitrobenzoate |
| Angielska nazwa | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
| MF | C9H9NO4 |
| Masie cząsteczkowej | 195.1721 |
| InChI | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| Nr CAS | 610-34-4 |
| EINECS | 210-220-0 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.253g/cm3 |
| Temperatura topnienia | 26-174℃ |
| Temperatura wrzenia | 275°C at 760 mmHg |
| Współczynnik załamania | 1.544 |
| Temperatura zapłonu | 126.1°C |
| Ciśnienie pary | 0.00523mmHg at 25°C |
| Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |