ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone |
|
| Chemical Name | alpha-Bromo-4-(diethylamino)acetophenone |
| Synonyms | 4-(Diethylamino)phenacyl bromide;2-bromo-1-[4-(diethylamino)phenyl]ethanone |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.1655 |
| InChl | InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number | 207986-25-2 |
| Molecular Structure | ![]() |
| Density | 1.316g/cm3 |
| Boiling Point | 357.7°C at 760 mmHg |
| Refractive Index | 1.572 |
| Flash Point | 170.1°C |
| Vapour Pressur | 2.69E-05mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |