71642-16-5 3-Methyl-2,4,6-tribromoaniline |
|
| Product Name | 3-Methyl-2,4,6-tribromoaniline |
| Synonyms | 2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine;2,4,6-Tribromo-m-toluidine;2,4,6-tribromo-3-methylaniline |
| Molecular Formula | C7H6Br3N |
| Molecular Weight | 343.8412 |
| InChl | InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
| CAS Registry Number | 71642-16-5 |
| Molecular Structure |  |
| Density | 2.196g/cm3 |
| Melting Point | 101-102℃ |
| Boiling Point | 314.1°C at 760 mmHg |
| Refractive Index | 1.668 |
| Flash Point | 143.8°C |
| Vapour Pressur | 0.000475mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
Chemindex > 71642-16-5 3-Methyl-2,4,6-tribromoaniline