ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate |
|
| Chemical Name | dimethyl fluoromalonate |
| Synonyms | Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester;Dimethyl 2-Fluoromalonate |
| Molecular Formula | C5H7FO4 |
| Molecular Weight | 150.1051 |
| InChl | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| CAS Registry Number | 344-14-9 |
| Molecular Structure | ![]() |
| Density | 1.211g/cm3 |
| Boiling Point | 140.3°C at 760 mmHg |
| Refractive Index | 1.382 |
| Flash Point | 38.4°C |
| Vapour Pressur | 6.18mmHg at 25°C |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |