ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate |
|
produktnavn | dimethyl fluoromalonate |
Engelsk navn | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester;Dimethyl 2-Fluoromalonate |
Molekylær Formel | C5H7FO4 |
Molekylvekt | 150.1051 |
InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS-nummer | 344-14-9 |
Molecular Structure | ![]() |
Tetthet | 1.211g/cm3 |
Kokepunkt | 140.3°C at 760 mmHg |
Brytningsindeks | 1.382 |
Flammepunktet | 38.4°C |
Damptrykk | 6.18mmHg at 25°C |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |