ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate | 
    |
| Nama produk | dimethyl fluoromalonate | 
| Nama Inggeris | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester;Dimethyl 2-Fluoromalonate | 
| MF | C5H7FO4 | 
| Berat Molekul | 150.1051 | 
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 | 
| CAS NO | 344-14-9 | 
| Struktur Molekul | ![]()  | 
    
| Kepadatan | 1.211g/cm3 | 
| Titik didih | 140.3°C at 760 mmHg | 
| Indeks bias | 1.382 | 
| Titik nyala | 38.4°C | 
| Tekanan wap | 6.18mmHg at 25°C | 
| Kod Risiko | R34##Causes burns.:; | 
    
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |