ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
344-14-9 dimethyl fluoromalonate |
|
| Nazwa produktu: | dimethyl fluoromalonate |
| Angielska nazwa | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester;Dimethyl 2-Fluoromalonate |
| MF | C5H7FO4 |
| Masie cząsteczkowej | 150.1051 |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Nr CAS | 344-14-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.211g/cm3 |
| Temperatura wrzenia | 140.3°C at 760 mmHg |
| Współczynnik załamania | 1.382 |
| Temperatura zapłonu | 38.4°C |
| Ciśnienie pary | 6.18mmHg at 25°C |
| Kody ryzyka | R34##Causes burns.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |