ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 52584-05-1 5-oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1) | |
| Chemical Name | 5-oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1) | 
| Synonyms | 5-Oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-oxo-L-proline - dodecyl 6-aminohexanoate (1:1) | 
| Molecular Formula | C23H44N2O5 | 
| Molecular Weight | 428.6059 | 
| InChl | InChI=1/C18H37NO2.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-14-17-21-18(20)15-12-11-13-16-19;7-4-2-1-3(6-4)5(8)9/h2-17,19H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 | 
| CAS Registry Number | 52584-05-1 | 
| EINECS | 258-022-3 | 
| Molecular Structure |  | 
| Boiling Point | 384°C at 760 mmHg | 
| Flash Point | 221.3°C | 
| Vapour Pressur | 4.21E-06mmHg at 25°C | 
| MSDS | |