Chemindex > 52584-05-1
NO ▼
52584-05-1 5-okso-L-prolin, forbindelse med dodecyl 6-aminoheksanoat (1:1) |
|
| produktnavn | 5-okso-L-prolin, forbindelse med dodecyl 6-aminoheksanoat (1:1) |
| Synonymer | 5-okso-L-prolin, forbindelse med dodecyl 6-aminoheksanoat (1:1); 5-okso-L-prolin - dodecyl 6-aminoheksanoat (1: 1); |
| Engelsk navn | 5-oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-Oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-oxo-L-proline - dodecyl 6-aminohexanoate (1:1) |
| Molekylær Formel | C23H44N2O5 |
| Molekylvekt | 428.6059 |
| InChI | InChI=1/C18H37NO2.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-14-17-21-18(20)15-12-11-13-16-19;7-4-2-1-3(6-4)5(8)9/h2-17,19H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| CAS-nummer | 52584-05-1 |
| EINECS | 258-022-3 |
| Molecular Structure |  |
| Kokepunkt | 384°C at 760 mmHg |
| Flammepunktet | 221.3°C |
| Damptrykk | 4.21E-06mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 52584-05-1 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 