ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52584-05-1 5-oxo-L-proline, composé avec dodécyle 6-aminohexanoate (1 :1) |
|
| Nom | 5-oxo-L-proline, composé avec dodécyle 6-aminohexanoate (1 :1) |
| Synonymes | 5-Oxo-L-proline, composé avec dodécyle 6-aminohexanoate (1 :1) ; 5-oxo-L-proline - dodécyle 6-aminohexanoate (1 :1) ; |
| Nom anglais | 5-oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-Oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-oxo-L-proline - dodecyl 6-aminohexanoate (1:1) |
| Formule moléculaire | C23H44N2O5 |
| Poids Moléculaire | 428.6059 |
| InChl | InChI=1/C18H37NO2.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-14-17-21-18(20)15-12-11-13-16-19;7-4-2-1-3(6-4)5(8)9/h2-17,19H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| Numéro de registre CAS | 52584-05-1 |
| EINECS | 258-022-3 |
| Structure moléculaire | ![]() |
| Point d'ébullition | 384°C at 760 mmHg |
| Point d'éclair | 221.3°C |
| Pression de vapeur | 4.21E-06mmHg at 25°C |
| MSDS | |