Chemindex >52584-05-1
MY ▼
52584-05-1 5-oxo-L-proline, kompaun dengan dodecyl 6-aminohexanoate (1:1) |
|
| Nama produk | 5-oxo-L-proline, kompaun dengan dodecyl 6-aminohexanoate (1:1) |
| Sinonim | 5-Oxo-L-proline, kompaun dengan dodecyl 6-aminohexanoate (1:1); 5-oxo-L-proline - dodecyl 6-aminohexanoate (1:1); |
| Nama Inggeris | 5-oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-Oxo-L-proline, compound with dodecyl 6-aminohexanoate (1:1);5-oxo-L-proline - dodecyl 6-aminohexanoate (1:1) |
| MF | C23H44N2O5 |
| Berat Molekul | 428.6059 |
| InChI | InChI=1/C18H37NO2.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-14-17-21-18(20)15-12-11-13-16-19;7-4-2-1-3(6-4)5(8)9/h2-17,19H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| CAS NO | 52584-05-1 |
| EINECS | 258-022-3 |
| Struktur Molekul |  |
| Titik didih | 384°C at 760 mmHg |
| Titik nyala | 221.3°C |
| Tekanan wap | 4.21E-06mmHg at 25°C |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 52584-05-1 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 