ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-88-8 2,3,4,5-tetrachlorfenylisothiokyanát |
|
| název výrobku | 2,3,4,5-tetrachlorfenylisothiokyanát |
| Synonyma | 1,2,3,4-tetrachlor-5-isothiokyanatozenbenzen; |
| Anglický název | 2,3,4,5-Tetrachlorophenyl isothiocyanate;1,2,3,4-tetrachloro-5-isothiocyanatobenzene |
| Molekulární vzorec | C7HCl4NS |
| Molekulová hmotnost | 272.9665 |
| InChl | InChI=1/C7HCl4NS/c8-3-1-4(12-2-13)6(10)7(11)5(3)9/h1H |
| Registrační číslo CAS | 206761-88-8 |
| Molekulární struktura | ![]() |
| Hustota | 1.63g/cm3 |
| Bod varu | 373.5°C at 760 mmHg |
| Index lomu | 1.649 |
| Bod vzplanutí | 179.7°C |
| Tlak par | 1.92E-05mmHg at 25°C |
| Riziko Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |