ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-88-8 2،3،4،5-تتراکلروفنیل ایزوتیوسیانات؛ 1،2،3،4-تتراکلرو-5-isothiocyanatobenzene؛ |
|
| نام محصول | 2،3،4،5-تتراکلروفنیل ایزوتیوسیانات؛ 1،2،3،4-تتراکلرو-5-isothiocyanatobenzene؛ |
| نام انگلیسی | 2,3,4,5-Tetrachlorophenyl isothiocyanate;1,2,3,4-tetrachloro-5-isothiocyanatobenzene |
| میدان مغناطیسی | C7HCl4NS |
| وزن مولکولی | 272.9665 |
| InChI | InChI=1/C7HCl4NS/c8-3-1-4(12-2-13)6(10)7(11)5(3)9/h1H |
| شماره سیایاس | 206761-88-8 |
| ساختار مولکولی | ![]() |
| تراکم | 1.63g/cm3 |
| نقطه غلیان | 373.5°C at 760 mmHg |
| ضریب شکست | 1.649 |
| نقطه اشتعال | 179.7°C |
| فشار بخار | 1.92E-05mmHg at 25°C |
| کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |